C29H26ClF4N5O2 — CID 134519368
(E)-4-[2-[[5-[(Z)-2-(2-chloro-4-fluorophenyl)-4,4,4-trifluoro-1-(1H-indazol-5-yl)but-1-enyl]-2-pyridinyl]oxy]ethylamino]-N-methylbut-2-enamide (PubChem CID 134519368) has the molecular formula C29H26ClF4N5O2 and a molecular weight of 588.01 g/mol. Its IUPAC name is (E)-4-[2-[[5-[(Z)-2-(2-chloro-4-fluorophenyl)-4,4,4-trifluoro-1-(1H-indazol-5-yl)but-1-enyl]-2-pyridinyl]oxy]ethylamino]-N-methylbut-2-enamide.
| Compound Name | (E)-4-[2-[[5-[(Z)-2-(2-chloro-4-fluorophenyl)-4,4,4-trifluoro-1-(1H-indazol-5-yl)but-1-enyl]-2-pyridinyl]oxy]ethylamino]-N-methylbut-2-enamide |
|---|---|
| PubChem CID | 134519368 |
| Molecular Formula | C29H26ClF4N5O2 |
| Molecular Weight | 588.01 g/mol |
| Exact Mass | 587.17 |
| IUPAC Name | (E)-4-[2-[[5-[(Z)-2-(2-chloro-4-fluorophenyl)-4,4,4-trifluoro-1-(1H-indazol-5-yl)but-1-enyl]-2-pyridinyl]oxy]ethylamino]-N-methylbut-2-enamide |
| SMILES | CNC(=O)/C=C/CNCCOc1ccc(/C(=C(/CC(F)(F)F)c2ccc(F)cc2Cl)c2ccc3[nH]ncc3c2)cn1 |
| InChI | InChI=1S/C29H26ClF4N5O2/c1-35-26(40)3-2-10-36-11-12-41-27-9-5-19(16-37-27)28(18-4-8-25-20(13-18)17-38-39-25)23(15-29(32,33)34)22-7-6-21(31)14-24(22)30/h2-9,13-14,16-17,36H,10-12,15H2,1H3,(H,35,40)(H,38,39)/b3-2+,28-23- |
| InChIKey | XEFZYSSUGMBPTJ-XMBAXDHASA-N |
| XLogP | 5.93 |
| TPSA | 91.93 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 588.01 |
| LogP ≤ 5 | 5.93 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|