C31H29F4N3O2 — CID 160921216
(E)-N-methyl-7-[[5-[(Z)-4,4,4-trifluoro-1-(3-fluoro-1H-indol-5-yl)-2-phenylbut-1-enyl]-2-pyridinyl]oxy]hept-2-enamide (PubChem CID 160921216) has the molecular formula C31H29F4N3O2 and a molecular weight of 551.58 g/mol. Its IUPAC name is (E)-N-methyl-7-[[5-[(Z)-4,4,4-trifluoro-1-(3-fluoro-1H-indol-5-yl)-2-phenylbut-1-enyl]-2-pyridinyl]oxy]hept-2-enamide.
| Compound Name | (E)-N-methyl-7-[[5-[(Z)-4,4,4-trifluoro-1-(3-fluoro-1H-indol-5-yl)-2-phenylbut-1-enyl]-2-pyridinyl]oxy]hept-2-enamide |
|---|---|
| PubChem CID | 160921216 |
| Molecular Formula | C31H29F4N3O2 |
| Molecular Weight | 551.58 g/mol |
| Exact Mass | 551.22 |
| IUPAC Name | (E)-N-methyl-7-[[5-[(Z)-4,4,4-trifluoro-1-(3-fluoro-1H-indol-5-yl)-2-phenylbut-1-enyl]-2-pyridinyl]oxy]hept-2-enamide |
| SMILES | CNC(=O)/C=C/CCCCOc1ccc(/C(=C(/CC(F)(F)F)c2ccccc2)c2ccc3[nH]cc(F)c3c2)cn1 |
| InChI | InChI=1S/C31H29F4N3O2/c1-36-28(39)11-7-2-3-8-16-40-29-15-13-23(19-38-29)30(22-12-14-27-24(17-22)26(32)20-37-27)25(18-31(33,34)35)21-9-5-4-6-10-21/h4-7,9-15,17,19-20,37H,2-3,8,16,18H2,1H3,(H,36,39)/b11-7+,30-25- |
| InChIKey | SSBAULAXRKYYSD-GPUGNPRWSA-N |
| XLogP | 7.46 |
| TPSA | 67.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 551.58 |
| LogP ≤ 5 | 7.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|