C29H30FN5O2 — CID 147207009
(E)-7-[6-[(Z)-1-(3-fluoro-2H-indazol-5-yl)-2-phenylbut-1-enyl]pyridazin-3-yl]oxy-N-methylhept-2-enamide (PubChem CID 147207009) has the molecular formula C29H30FN5O2 and a molecular weight of 499.59 g/mol. Its IUPAC name is (E)-7-[6-[(Z)-1-(3-fluoro-2H-indazol-5-yl)-2-phenylbut-1-enyl]pyridazin-3-yl]oxy-N-methylhept-2-enamide.
| Compound Name | (E)-7-[6-[(Z)-1-(3-fluoro-2H-indazol-5-yl)-2-phenylbut-1-enyl]pyridazin-3-yl]oxy-N-methylhept-2-enamide |
|---|---|
| PubChem CID | 147207009 |
| Molecular Formula | C29H30FN5O2 |
| Molecular Weight | 499.59 g/mol |
| Exact Mass | 499.24 |
| IUPAC Name | (E)-7-[6-[(Z)-1-(3-fluoro-2H-indazol-5-yl)-2-phenylbut-1-enyl]pyridazin-3-yl]oxy-N-methylhept-2-enamide |
| SMILES | CC/C(=C(\c1ccc2n[nH]c(F)c2c1)c1ccc(OCCCC/C=C/C(=O)NC)nn1)c1ccccc1 |
| InChI | InChI=1S/C29H30FN5O2/c1-3-22(20-11-7-6-8-12-20)28(21-14-15-24-23(19-21)29(30)35-32-24)25-16-17-27(34-33-25)37-18-10-5-4-9-13-26(36)31-2/h6-9,11-17,19H,3-5,10,18H2,1-2H3,(H,31,36)(H,32,35)/b13-9+,28-22- |
| InChIKey | CELTWCXXPSLNDW-VNLFLIEYSA-N |
| XLogP | 5.71 |
| TPSA | 92.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.59 |
| LogP ≤ 5 | 5.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|