C30H30ClFN4O2 — CID 134519365
(E)-4-[2-[4-[(E)-4-chloro-1-(3-fluoro-2H-indazol-5-yl)-2-phenylbut-1-enyl]phenoxy]ethylamino]-N-methylbut-2-enamide (PubChem CID 134519365) has the molecular formula C30H30ClFN4O2 and a molecular weight of 533.05 g/mol. Its IUPAC name is (E)-4-[2-[4-[(E)-4-chloro-1-(3-fluoro-2H-indazol-5-yl)-2-phenylbut-1-enyl]phenoxy]ethylamino]-N-methylbut-2-enamide.
| Compound Name | (E)-4-[2-[4-[(E)-4-chloro-1-(3-fluoro-2H-indazol-5-yl)-2-phenylbut-1-enyl]phenoxy]ethylamino]-N-methylbut-2-enamide |
|---|---|
| PubChem CID | 134519365 |
| Molecular Formula | C30H30ClFN4O2 |
| Molecular Weight | 533.05 g/mol |
| Exact Mass | 532.20 |
| IUPAC Name | (E)-4-[2-[4-[(E)-4-chloro-1-(3-fluoro-2H-indazol-5-yl)-2-phenylbut-1-enyl]phenoxy]ethylamino]-N-methylbut-2-enamide |
| SMILES | CNC(=O)/C=C/CNCCOc1ccc(/C(=C(/CCCl)c2ccccc2)c2ccc3n[nH]c(F)c3c2)cc1 |
| InChI | InChI=1S/C30H30ClFN4O2/c1-33-28(37)8-5-17-34-18-19-38-24-12-9-22(10-13-24)29(25(15-16-31)21-6-3-2-4-7-21)23-11-14-27-26(20-23)30(32)36-35-27/h2-14,20,34H,15-19H2,1H3,(H,33,37)(H,35,36)/b8-5+,29-25+ |
| InChIKey | ORQQPSBLEAKLLQ-SALCHAQFSA-N |
| XLogP | 5.56 |
| TPSA | 79.04 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 533.05 |
| LogP ≤ 5 | 5.56 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|