C31H30F4N4O2 — CID 134519361
(E)-N,N-bis(trideuteriomethyl)-4-[2-[4-[(E)-4,4,4-trifluoro-1-(3-fluoro-2H-indazol-5-yl)-2-phenylbut-1-enyl]phenoxy]ethylamino]but-2-enamide (PubChem CID 134519361) has the molecular formula C31H30F4N4O2 and a molecular weight of 572.64 g/mol. Its IUPAC name is (E)-N,N-bis(trideuteriomethyl)-4-[2-[4-[(E)-4,4,4-trifluoro-1-(3-fluoro-2H-indazol-5-yl)-2-phenylbut-1-enyl]phenoxy]ethylamino]but-2-enamide.
| Compound Name | (E)-N,N-bis(trideuteriomethyl)-4-[2-[4-[(E)-4,4,4-trifluoro-1-(3-fluoro-2H-indazol-5-yl)-2-phenylbut-1-enyl]phenoxy]ethylamino]but-2-enamide |
|---|---|
| PubChem CID | 134519361 |
| Molecular Formula | C31H30F4N4O2 |
| Molecular Weight | 572.64 g/mol |
| Exact Mass | 572.27 |
| IUPAC Name | (E)-N,N-bis(trideuteriomethyl)-4-[2-[4-[(E)-4,4,4-trifluoro-1-(3-fluoro-2H-indazol-5-yl)-2-phenylbut-1-enyl]phenoxy]ethylamino]but-2-enamide |
| SMILES | [2H]C([2H])([2H])N(C(=O)/C=C/CNCCOc1ccc(/C(=C(/CC(F)(F)F)c2ccccc2)c2ccc3n[nH]c(F)c3c2)cc1)C([2H])([2H])[2H] |
| InChI | InChI=1S/C31H30F4N4O2/c1-39(2)28(40)9-6-16-36-17-18-41-24-13-10-22(11-14-24)29(23-12-15-27-25(19-23)30(32)38-37-27)26(20-31(33,34)35)21-7-4-3-5-8-21/h3-15,19,36H,16-18,20H2,1-2H3,(H,37,38)/b9-6+,29-26+/i1D3,2D3 |
| InChIKey | STJCSULDLUUSDZ-QEFJFSILSA-N |
| XLogP | 6.23 |
| TPSA | 70.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 572.64 |
| LogP ≤ 5 | 6.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|