C33H40N2O2 — CID 145199754
(E)-N,N-dimethyl-4-[2-[4-[(Z)-1-phenyl-2-(4-propan-2-ylphenyl)but-1-enyl]phenoxy]ethylamino]but-2-enamide (PubChem CID 145199754) has the molecular formula C33H40N2O2 and a molecular weight of 496.70 g/mol. Its IUPAC name is (E)-N,N-dimethyl-4-[2-[4-[(Z)-1-phenyl-2-(4-propan-2-ylphenyl)but-1-enyl]phenoxy]ethylamino]but-2-enamide.
| Compound Name | (E)-N,N-dimethyl-4-[2-[4-[(Z)-1-phenyl-2-(4-propan-2-ylphenyl)but-1-enyl]phenoxy]ethylamino]but-2-enamide |
|---|---|
| PubChem CID | 145199754 |
| Molecular Formula | C33H40N2O2 |
| Molecular Weight | 496.70 g/mol |
| Exact Mass | 496.31 |
| IUPAC Name | (E)-N,N-dimethyl-4-[2-[4-[(Z)-1-phenyl-2-(4-propan-2-ylphenyl)but-1-enyl]phenoxy]ethylamino]but-2-enamide |
| SMILES | CC/C(=C(\c1ccccc1)c1ccc(OCCNC/C=C/C(=O)N(C)C)cc1)c1ccc(C(C)C)cc1 |
| InChI | InChI=1S/C33H40N2O2/c1-6-31(27-16-14-26(15-17-27)25(2)3)33(28-11-8-7-9-12-28)29-18-20-30(21-19-29)37-24-23-34-22-10-13-32(36)35(4)5/h7-21,25,34H,6,22-24H2,1-5H3/b13-10+,33-31- |
| InChIKey | NYGQXSIRUZVAGD-VPGCLEOWSA-N |
| XLogP | 6.79 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.70 |
| LogP ≤ 5 | 6.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|