C32H37FN4O3 — CID 145199935
(E)-4-[2-[4-[(E)-1-(4-amino-3-methanimidoylphenyl)-2-[2-(fluoromethoxy)phenyl]but-1-enyl]phenoxy]ethylamino]-N,N-dimethylbut-2-enamide (PubChem CID 145199935) has the molecular formula C32H37FN4O3 and a molecular weight of 544.67 g/mol. Its IUPAC name is (E)-4-[2-[4-[(E)-1-(4-amino-3-methanimidoylphenyl)-2-[2-(fluoromethoxy)phenyl]but-1-enyl]phenoxy]ethylamino]-N,N-dimethylbut-2-enamide.
| Compound Name | (E)-4-[2-[4-[(E)-1-(4-amino-3-methanimidoylphenyl)-2-[2-(fluoromethoxy)phenyl]but-1-enyl]phenoxy]ethylamino]-N,N-dimethylbut-2-enamide |
|---|---|
| PubChem CID | 145199935 |
| Molecular Formula | C32H37FN4O3 |
| Molecular Weight | 544.67 g/mol |
| Exact Mass | 544.28 |
| IUPAC Name | (E)-4-[2-[4-[(E)-1-(4-amino-3-methanimidoylphenyl)-2-[2-(fluoromethoxy)phenyl]but-1-enyl]phenoxy]ethylamino]-N,N-dimethylbut-2-enamide |
| SMILES | [H]/N=C/c1cc(/C(=C(\CC)c2ccccc2OCF)c2ccc(OCCNC/C=C/C(=O)N(C)C)cc2)ccc1N |
| InChI | InChI=1S/C32H37FN4O3/c1-4-27(28-8-5-6-9-30(28)40-22-33)32(24-13-16-29(35)25(20-24)21-34)23-11-14-26(15-12-23)39-19-18-36-17-7-10-31(38)37(2)3/h5-16,20-21,34,36H,4,17-19,22,35H2,1-3H3/b10-7+,32-27+,34-21+ |
| InChIKey | IGKNIVLAONUMIA-LXNDZPBGSA-N |
| XLogP | 5.55 |
| TPSA | 100.67 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.67 |
| LogP ≤ 5 | 5.55 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|