C33H38N4O3 — CID 154956933
(E)-4-[2-[[5-[(E)-2-(3-methoxyphenyl)-1-(3-methyl-1H-indol-2-yl)but-1-enyl]-2-pyridinyl]oxy]ethylamino]-N,N-dimethylbut-2-enamide (PubChem CID 154956933) has the molecular formula C33H38N4O3 and a molecular weight of 538.69 g/mol. Its IUPAC name is (E)-4-[2-[[5-[(E)-2-(3-methoxyphenyl)-1-(3-methyl-1H-indol-2-yl)but-1-enyl]-2-pyridinyl]oxy]ethylamino]-N,N-dimethylbut-2-enamide.
| Compound Name | (E)-4-[2-[[5-[(E)-2-(3-methoxyphenyl)-1-(3-methyl-1H-indol-2-yl)but-1-enyl]-2-pyridinyl]oxy]ethylamino]-N,N-dimethylbut-2-enamide |
|---|---|
| PubChem CID | 154956933 |
| Molecular Formula | C33H38N4O3 |
| Molecular Weight | 538.69 g/mol |
| Exact Mass | 538.29 |
| IUPAC Name | (E)-4-[2-[[5-[(E)-2-(3-methoxyphenyl)-1-(3-methyl-1H-indol-2-yl)but-1-enyl]-2-pyridinyl]oxy]ethylamino]-N,N-dimethylbut-2-enamide |
| SMILES | CC/C(=C(/c1ccc(OCCNC/C=C/C(=O)N(C)C)nc1)c1[nH]c2ccccc2c1C)c1cccc(OC)c1 |
| InChI | InChI=1S/C33H38N4O3/c1-6-27(24-11-9-12-26(21-24)39-5)32(33-23(2)28-13-7-8-14-29(28)36-33)25-16-17-30(35-22-25)40-20-19-34-18-10-15-31(38)37(3)4/h7-17,21-22,34,36H,6,18-20H2,1-5H3/b15-10+,32-27+ |
| InChIKey | BQVKWMCOZYASKM-ITEJJYCDSA-N |
| XLogP | 5.86 |
| TPSA | 79.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.69 |
| LogP ≤ 5 | 5.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|