C34H38ClN3O3 — CID 163905915
(E)-7-[[5-[(E)-1-(3-chloro-1H-indol-2-yl)-2-(3-methoxyphenyl)but-1-enyl]-2-pyridinyl]oxy]-N,N,4-trimethylhept-2-enamide (PubChem CID 163905915) has the molecular formula C34H38ClN3O3 and a molecular weight of 572.15 g/mol. Its IUPAC name is (E)-7-[[5-[(E)-1-(3-chloro-1H-indol-2-yl)-2-(3-methoxyphenyl)but-1-enyl]-2-pyridinyl]oxy]-N,N,4-trimethylhept-2-enamide.
| Compound Name | (E)-7-[[5-[(E)-1-(3-chloro-1H-indol-2-yl)-2-(3-methoxyphenyl)but-1-enyl]-2-pyridinyl]oxy]-N,N,4-trimethylhept-2-enamide |
|---|---|
| PubChem CID | 163905915 |
| Molecular Formula | C34H38ClN3O3 |
| Molecular Weight | 572.15 g/mol |
| Exact Mass | 571.26 |
| IUPAC Name | (E)-7-[[5-[(E)-1-(3-chloro-1H-indol-2-yl)-2-(3-methoxyphenyl)but-1-enyl]-2-pyridinyl]oxy]-N,N,4-trimethylhept-2-enamide |
| SMILES | CC/C(=C(/c1ccc(OCCCC(C)/C=C/C(=O)N(C)C)nc1)c1[nH]c2ccccc2c1Cl)c1cccc(OC)c1 |
| InChI | InChI=1S/C34H38ClN3O3/c1-6-27(24-12-9-13-26(21-24)40-5)32(34-33(35)28-14-7-8-15-29(28)37-34)25-17-18-30(36-22-25)41-20-10-11-23(2)16-19-31(39)38(3)4/h7-9,12-19,21-23,37H,6,10-11,20H2,1-5H3/b19-16+,32-27+ |
| InChIKey | BHYBUPUUOSTEBW-VLZIDGQTSA-N |
| XLogP | 8.03 |
| TPSA | 67.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 572.15 |
| LogP ≤ 5 | 8.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|