C33H36ClN3O2 — CID 163948115
(E)-7-[[5-[(E)-1-(3-chloro-1H-indol-2-yl)-2-phenylbut-1-enyl]-2-pyridinyl]oxy]-N,N,4-trimethylhept-2-enamide (PubChem CID 163948115) has the molecular formula C33H36ClN3O2 and a molecular weight of 542.12 g/mol. Its IUPAC name is (E)-7-[[5-[(E)-1-(3-chloro-1H-indol-2-yl)-2-phenylbut-1-enyl]-2-pyridinyl]oxy]-N,N,4-trimethylhept-2-enamide.
| Compound Name | (E)-7-[[5-[(E)-1-(3-chloro-1H-indol-2-yl)-2-phenylbut-1-enyl]-2-pyridinyl]oxy]-N,N,4-trimethylhept-2-enamide |
|---|---|
| PubChem CID | 163948115 |
| Molecular Formula | C33H36ClN3O2 |
| Molecular Weight | 542.12 g/mol |
| Exact Mass | 541.25 |
| IUPAC Name | (E)-7-[[5-[(E)-1-(3-chloro-1H-indol-2-yl)-2-phenylbut-1-enyl]-2-pyridinyl]oxy]-N,N,4-trimethylhept-2-enamide |
| SMILES | CC/C(=C(/c1ccc(OCCCC(C)/C=C/C(=O)N(C)C)nc1)c1[nH]c2ccccc2c1Cl)c1ccccc1 |
| InChI | InChI=1S/C33H36ClN3O2/c1-5-26(24-13-7-6-8-14-24)31(33-32(34)27-15-9-10-16-28(27)36-33)25-18-19-29(35-22-25)39-21-11-12-23(2)17-20-30(38)37(3)4/h6-10,13-20,22-23,36H,5,11-12,21H2,1-4H3/b20-17+,31-26+ |
| InChIKey | MFTHESSERBGCNY-XRQRNUQESA-N |
| XLogP | 8.02 |
| TPSA | 58.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.12 |
| LogP ≤ 5 | 8.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|