C33H36ClN3O3 — CID 163589771
(E)-7-[[5-[(E)-1-(3-chloro-1H-indol-2-yl)-2-(3-methoxyphenyl)but-1-enyl]-2-pyridinyl]oxy]-N,N-dimethylhept-2-enamide (PubChem CID 163589771) has the molecular formula C33H36ClN3O3 and a molecular weight of 558.12 g/mol. Its IUPAC name is (E)-7-[[5-[(E)-1-(3-chloro-1H-indol-2-yl)-2-(3-methoxyphenyl)but-1-enyl]-2-pyridinyl]oxy]-N,N-dimethylhept-2-enamide.
| Compound Name | (E)-7-[[5-[(E)-1-(3-chloro-1H-indol-2-yl)-2-(3-methoxyphenyl)but-1-enyl]-2-pyridinyl]oxy]-N,N-dimethylhept-2-enamide |
|---|---|
| PubChem CID | 163589771 |
| Molecular Formula | C33H36ClN3O3 |
| Molecular Weight | 558.12 g/mol |
| Exact Mass | 557.24 |
| IUPAC Name | (E)-7-[[5-[(E)-1-(3-chloro-1H-indol-2-yl)-2-(3-methoxyphenyl)but-1-enyl]-2-pyridinyl]oxy]-N,N-dimethylhept-2-enamide |
| SMILES | CC/C(=C(/c1ccc(OCCCC/C=C/C(=O)N(C)C)nc1)c1[nH]c2ccccc2c1Cl)c1cccc(OC)c1 |
| InChI | InChI=1S/C33H36ClN3O3/c1-5-26(23-13-12-14-25(21-23)39-4)31(33-32(34)27-15-9-10-16-28(27)36-33)24-18-19-29(35-22-24)40-20-11-7-6-8-17-30(38)37(2)3/h8-10,12-19,21-22,36H,5-7,11,20H2,1-4H3/b17-8+,31-26+ |
| InChIKey | FFTFTFNRBKPANT-FYYFXTKJSA-N |
| XLogP | 7.79 |
| TPSA | 67.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 558.12 |
| LogP ≤ 5 | 7.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|