C30H38FN5O2 — CID 145199948
2-amino-5-[(E)-1-[4-[2-[[(E)-4-(dimethylamino)-4-oxobut-2-enyl]amino]ethoxy]phenyl]-2-pyridin-2-ylbut-1-enyl]benzenecarboximidoyl fluoride;molecular hydrogen (PubChem CID 145199948) has the molecular formula C30H38FN5O2 and a molecular weight of 519.67 g/mol. Its IUPAC name is 2-amino-5-[(E)-1-[4-[2-[[(E)-4-(dimethylamino)-4-oxobut-2-enyl]amino]ethoxy]phenyl]-2-pyridin-2-ylbut-1-enyl]benzenecarboximidoyl fluoride;molecular hydrogen.
| Compound Name | 2-amino-5-[(E)-1-[4-[2-[[(E)-4-(dimethylamino)-4-oxobut-2-enyl]amino]ethoxy]phenyl]-2-pyridin-2-ylbut-1-enyl]benzenecarboximidoyl fluoride;molecular hydrogen |
|---|---|
| PubChem CID | 145199948 |
| Molecular Formula | C30H38FN5O2 |
| Molecular Weight | 519.67 g/mol |
| Exact Mass | 519.30 |
| IUPAC Name | 2-amino-5-[(E)-1-[4-[2-[[(E)-4-(dimethylamino)-4-oxobut-2-enyl]amino]ethoxy]phenyl]-2-pyridin-2-ylbut-1-enyl]benzenecarboximidoyl fluoride;molecular hydrogen |
| SMILES | [H]/N=C(\F)c1cc(/C(=C(\CC)c2ccccn2)c2ccc(OCCNC/C=C/C(=O)N(C)C)cc2)ccc1N.[H][H].[H][H] |
| InChI | InChI=1S/C30H34FN5O2.2H2/c1-4-24(27-8-5-6-17-35-27)29(22-12-15-26(32)25(20-22)30(31)33)21-10-13-23(14-11-21)38-19-18-34-16-7-9-28(37)36(2)3;;/h5-15,17,20,33-34H,4,16,18-19,32H2,1-3H3;2*1H/b9-7+,29-24+,33-30-;; |
| InChIKey | FSGIIIYYAKRQCB-FSQRYQBYSA-N |
| XLogP | 5.43 |
| TPSA | 104.33 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.67 |
| LogP ≤ 5 | 5.43 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|