C29H35FN4 — CID 134555784
2-amino-5-[(E)-1-[4-[3-[1-(methylamino)ethylamino]propyl]phenyl]-2-phenylbut-1-enyl]benzenecarboximidoyl fluoride (PubChem CID 134555784) has the molecular formula C29H35FN4 and a molecular weight of 458.63 g/mol. Its IUPAC name is 2-amino-5-[(E)-1-[4-[3-[1-(methylamino)ethylamino]propyl]phenyl]-2-phenylbut-1-enyl]benzenecarboximidoyl fluoride.
| Compound Name | 2-amino-5-[(E)-1-[4-[3-[1-(methylamino)ethylamino]propyl]phenyl]-2-phenylbut-1-enyl]benzenecarboximidoyl fluoride |
|---|---|
| PubChem CID | 134555784 |
| Molecular Formula | C29H35FN4 |
| Molecular Weight | 458.63 g/mol |
| Exact Mass | 458.28 |
| IUPAC Name | 2-amino-5-[(E)-1-[4-[3-[1-(methylamino)ethylamino]propyl]phenyl]-2-phenylbut-1-enyl]benzenecarboximidoyl fluoride |
| SMILES | [H]/N=C(\F)c1cc(/C(=C(\CC)c2ccccc2)c2ccc(CCCNC(C)NC)cc2)ccc1N |
| InChI | InChI=1S/C29H35FN4/c1-4-25(22-10-6-5-7-11-22)28(24-16-17-27(31)26(19-24)29(30)32)23-14-12-21(13-15-23)9-8-18-34-20(2)33-3/h5-7,10-17,19-20,32-34H,4,8-9,18,31H2,1-3H3/b28-25+,32-29- |
| InChIKey | IVZYJBBDYGTNBE-AOWBPEQJSA-N |
| XLogP | 6.02 |
| TPSA | 73.93 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.63 |
| LogP ≤ 5 | 6.02 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|