C29H33NO — CID 67590855
2-[4-(1,2-diphenylbut-1-enyl)phenyl]-N,N-diethylpropanamide (PubChem CID 67590855) has the molecular formula C29H33NO and a molecular weight of 411.59 g/mol. Its IUPAC name is 2-[4-(1,2-diphenylbut-1-enyl)phenyl]-N,N-diethylpropanamide.
| Compound Name | 2-[4-(1,2-diphenylbut-1-enyl)phenyl]-N,N-diethylpropanamide |
|---|---|
| PubChem CID | 67590855 |
| Molecular Formula | C29H33NO |
| Molecular Weight | 411.59 g/mol |
| Exact Mass | 411.26 |
| IUPAC Name | 2-[4-(1,2-diphenylbut-1-enyl)phenyl]-N,N-diethylpropanamide |
| SMILES | CCC(=C(c1ccccc1)c1ccc(C(C)C(=O)N(CC)CC)cc1)c1ccccc1 |
| InChI | InChI=1S/C29H33NO/c1-5-27(24-14-10-8-11-15-24)28(25-16-12-9-13-17-25)26-20-18-23(19-21-26)22(4)29(31)30(6-2)7-3/h8-22H,5-7H2,1-4H3 |
| InChIKey | YJIFPMNBKWATIJ-UHFFFAOYSA-N |
| XLogP | 7.03 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.59 |
| LogP ≤ 5 | 7.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|