C25H23F4N3O — CID 145199676
2-amino-5-[(E)-1-[4-(2-aminoethoxy)phenyl]-4,4,4-trifluoro-2-phenylbut-1-enyl]benzenecarboximidoyl fluoride (PubChem CID 145199676) has the molecular formula C25H23F4N3O and a molecular weight of 457.47 g/mol. Its IUPAC name is 2-amino-5-[(E)-1-[4-(2-aminoethoxy)phenyl]-4,4,4-trifluoro-2-phenylbut-1-enyl]benzenecarboximidoyl fluoride.
| Compound Name | 2-amino-5-[(E)-1-[4-(2-aminoethoxy)phenyl]-4,4,4-trifluoro-2-phenylbut-1-enyl]benzenecarboximidoyl fluoride |
|---|---|
| PubChem CID | 145199676 |
| Molecular Formula | C25H23F4N3O |
| Molecular Weight | 457.47 g/mol |
| Exact Mass | 457.18 |
| IUPAC Name | 2-amino-5-[(E)-1-[4-(2-aminoethoxy)phenyl]-4,4,4-trifluoro-2-phenylbut-1-enyl]benzenecarboximidoyl fluoride |
| SMILES | [H]/N=C(\F)c1cc(/C(=C(\CC(F)(F)F)c2ccccc2)c2ccc(OCCN)cc2)ccc1N |
| InChI | InChI=1S/C25H23F4N3O/c26-24(32)20-14-18(8-11-22(20)31)23(17-6-9-19(10-7-17)33-13-12-30)21(15-25(27,28)29)16-4-2-1-3-5-16/h1-11,14,32H,12-13,15,30-31H2/b23-21+,32-24- |
| InChIKey | GOWGJABYUUNYSU-APYBIVSHSA-N |
| XLogP | 5.81 |
| TPSA | 85.12 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.47 |
| LogP ≤ 5 | 5.81 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|