C29H29F2N3O2 — CID 145199552
2-amino-5-[(E)-2-(4-fluorophenyl)-1-[4-[2-[[(E)-4-oxobut-2-enyl]amino]ethoxy]phenyl]but-1-enyl]benzenecarboximidoyl fluoride (PubChem CID 145199552) has the molecular formula C29H29F2N3O2 and a molecular weight of 489.57 g/mol. Its IUPAC name is 2-amino-5-[(E)-2-(4-fluorophenyl)-1-[4-[2-[[(E)-4-oxobut-2-enyl]amino]ethoxy]phenyl]but-1-enyl]benzenecarboximidoyl fluoride.
| Compound Name | 2-amino-5-[(E)-2-(4-fluorophenyl)-1-[4-[2-[[(E)-4-oxobut-2-enyl]amino]ethoxy]phenyl]but-1-enyl]benzenecarboximidoyl fluoride |
|---|---|
| PubChem CID | 145199552 |
| Molecular Formula | C29H29F2N3O2 |
| Molecular Weight | 489.57 g/mol |
| Exact Mass | 489.22 |
| IUPAC Name | 2-amino-5-[(E)-2-(4-fluorophenyl)-1-[4-[2-[[(E)-4-oxobut-2-enyl]amino]ethoxy]phenyl]but-1-enyl]benzenecarboximidoyl fluoride |
| SMILES | [H]/N=C(\F)c1cc(/C(=C(\CC)c2ccc(F)cc2)c2ccc(OCCNC/C=C/C=O)cc2)ccc1N |
| InChI | InChI=1S/C29H29F2N3O2/c1-2-25(20-5-10-23(30)11-6-20)28(22-9-14-27(32)26(19-22)29(31)33)21-7-12-24(13-8-21)36-18-16-34-15-3-4-17-35/h3-14,17,19,33-34H,2,15-16,18,32H2,1H3/b4-3+,28-25+,33-29- |
| InChIKey | IFPJCDGCOYCFJT-VOCWBFBWSA-N |
| XLogP | 5.80 |
| TPSA | 88.20 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.57 |
| LogP ≤ 5 | 5.80 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|