C32H34F4N4O2 — CID 155430567
2-(oxan-2-ylamino)-5-[(Z)-4,4,4-trifluoro-2-phenyl-1-[6-[(3R)-piperidin-3-yl]oxy-3-pyridinyl]but-1-enyl]benzenecarboximidoyl fluoride (PubChem CID 155430567) has the molecular formula C32H34F4N4O2 and a molecular weight of 582.64 g/mol. Its IUPAC name is 2-(oxan-2-ylamino)-5-[(Z)-4,4,4-trifluoro-2-phenyl-1-[6-[(3R)-piperidin-3-yl]oxy-3-pyridinyl]but-1-enyl]benzenecarboximidoyl fluoride.
| Compound Name | 2-(oxan-2-ylamino)-5-[(Z)-4,4,4-trifluoro-2-phenyl-1-[6-[(3R)-piperidin-3-yl]oxy-3-pyridinyl]but-1-enyl]benzenecarboximidoyl fluoride |
|---|---|
| PubChem CID | 155430567 |
| Molecular Formula | C32H34F4N4O2 |
| Molecular Weight | 582.64 g/mol |
| Exact Mass | 582.26 |
| IUPAC Name | 2-(oxan-2-ylamino)-5-[(Z)-4,4,4-trifluoro-2-phenyl-1-[6-[(3R)-piperidin-3-yl]oxy-3-pyridinyl]but-1-enyl]benzenecarboximidoyl fluoride |
| SMILES | [H]/N=C(\F)c1cc(/C(=C(\CC(F)(F)F)c2ccccc2)c2ccc(O[C@@H]3CCCNC3)nc2)ccc1NC1CCCCO1 |
| InChI | InChI=1S/C32H34F4N4O2/c33-31(37)25-17-22(11-13-27(25)40-29-10-4-5-16-41-29)30(26(18-32(34,35)36)21-7-2-1-3-8-21)23-12-14-28(39-19-23)42-24-9-6-15-38-20-24/h1-3,7-8,11-14,17,19,24,29,37-38,40H,4-6,9-10,15-16,18,20H2/b30-26-,37-31-/t24-,29?/m1/s1 |
| InChIKey | NBKKAHQPOHSRLG-HUJILGKPSA-N |
| XLogP | 7.36 |
| TPSA | 79.26 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 582.64 |
| LogP ≤ 5 | 7.36 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|