C25H21F4N3O — CID 154620210
2-[4-[(E)-4,4,4-trifluoro-1-(3-fluoroindazol-1-yl)-2-phenylbut-1-enyl]phenoxy]ethanamine (PubChem CID 154620210) has the molecular formula C25H21F4N3O and a molecular weight of 455.46 g/mol. Its IUPAC name is 2-[4-[(E)-4,4,4-trifluoro-1-(3-fluoroindazol-1-yl)-2-phenylbut-1-enyl]phenoxy]ethanamine.
| Compound Name | 2-[4-[(E)-4,4,4-trifluoro-1-(3-fluoroindazol-1-yl)-2-phenylbut-1-enyl]phenoxy]ethanamine |
|---|---|
| PubChem CID | 154620210 |
| Molecular Formula | C25H21F4N3O |
| Molecular Weight | 455.46 g/mol |
| Exact Mass | 455.16 |
| IUPAC Name | 2-[4-[(E)-4,4,4-trifluoro-1-(3-fluoroindazol-1-yl)-2-phenylbut-1-enyl]phenoxy]ethanamine |
| SMILES | NCCOc1ccc(/C(=C(/CC(F)(F)F)c2ccccc2)n2nc(F)c3ccccc32)cc1 |
| InChI | InChI=1S/C25H21F4N3O/c26-24-20-8-4-5-9-22(20)32(31-24)23(18-10-12-19(13-11-18)33-15-14-30)21(16-25(27,28)29)17-6-2-1-3-7-17/h1-13H,14-16,30H2/b23-21+ |
| InChIKey | JCOIUGJVRZBSDE-XTQSDGFTSA-N |
| XLogP | 5.88 |
| TPSA | 53.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.46 |
| LogP ≤ 5 | 5.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|