C28H33N — CID 145199812
N-ethyl-3-[4-[(Z)-1-(4-methylphenyl)-2-phenylbut-1-enyl]phenyl]propan-1-amine (PubChem CID 145199812) has the molecular formula C28H33N and a molecular weight of 383.58 g/mol. Its IUPAC name is N-ethyl-3-[4-[(Z)-1-(4-methylphenyl)-2-phenylbut-1-enyl]phenyl]propan-1-amine.
| Compound Name | N-ethyl-3-[4-[(Z)-1-(4-methylphenyl)-2-phenylbut-1-enyl]phenyl]propan-1-amine |
|---|---|
| PubChem CID | 145199812 |
| Molecular Formula | C28H33N |
| Molecular Weight | 383.58 g/mol |
| Exact Mass | 383.26 |
| IUPAC Name | N-ethyl-3-[4-[(Z)-1-(4-methylphenyl)-2-phenylbut-1-enyl]phenyl]propan-1-amine |
| SMILES | CCNCCCc1ccc(/C(=C(/CC)c2ccccc2)c2ccc(C)cc2)cc1 |
| InChI | InChI=1S/C28H33N/c1-4-27(24-11-7-6-8-12-24)28(25-17-13-22(3)14-18-25)26-19-15-23(16-20-26)10-9-21-29-5-2/h6-8,11-20,29H,4-5,9-10,21H2,1-3H3/b28-27- |
| InChIKey | CLUMYQLGBYDDJH-DQSJHHFOSA-N |
| XLogP | 6.91 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.58 |
| LogP ≤ 5 | 6.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|