C34H45N3O3 — CID 145199869
2-[2-[4-[(E)-1-[4-(1-ethoxybutylamino)-3-methanimidoylphenyl]-2-(2-methylphenyl)but-1-enyl]phenoxy]ethylamino]ethanol (PubChem CID 145199869) has the molecular formula C34H45N3O3 and a molecular weight of 543.75 g/mol. Its IUPAC name is 2-[2-[4-[(E)-1-[4-(1-ethoxybutylamino)-3-methanimidoylphenyl]-2-(2-methylphenyl)but-1-enyl]phenoxy]ethylamino]ethanol.
| Compound Name | 2-[2-[4-[(E)-1-[4-(1-ethoxybutylamino)-3-methanimidoylphenyl]-2-(2-methylphenyl)but-1-enyl]phenoxy]ethylamino]ethanol |
|---|---|
| PubChem CID | 145199869 |
| Molecular Formula | C34H45N3O3 |
| Molecular Weight | 543.75 g/mol |
| Exact Mass | 543.35 |
| IUPAC Name | 2-[2-[4-[(E)-1-[4-(1-ethoxybutylamino)-3-methanimidoylphenyl]-2-(2-methylphenyl)but-1-enyl]phenoxy]ethylamino]ethanol |
| SMILES | [H]/N=C/c1cc(/C(=C(\CC)c2ccccc2C)c2ccc(OCCNCCO)cc2)ccc1NC(CCC)OCC |
| InChI | InChI=1S/C34H45N3O3/c1-5-10-33(39-7-3)37-32-18-15-27(23-28(32)24-35)34(30(6-2)31-12-9-8-11-25(31)4)26-13-16-29(17-14-26)40-22-20-36-19-21-38/h8-9,11-18,23-24,33,35-38H,5-7,10,19-22H2,1-4H3/b34-30+,35-24+ |
| InChIKey | KPJHYWIETRVVNJ-LMFBFEJTSA-N |
| XLogP | 6.90 |
| TPSA | 86.60 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 543.75 |
| LogP ≤ 5 | 6.90 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|