C36H38N2O6 — CID 166082031
2-ethoxy-2-[2-methanimidoyl-4-[3-[4-(4-phenylbenzoyl)-2-propylphenoxy]propoxy]anilino]acetic acid (PubChem CID 166082031) has the molecular formula C36H38N2O6 and a molecular weight of 594.71 g/mol. Its IUPAC name is 2-ethoxy-2-[2-methanimidoyl-4-[3-[4-(4-phenylbenzoyl)-2-propylphenoxy]propoxy]anilino]acetic acid.
| Compound Name | 2-ethoxy-2-[2-methanimidoyl-4-[3-[4-(4-phenylbenzoyl)-2-propylphenoxy]propoxy]anilino]acetic acid |
|---|---|
| PubChem CID | 166082031 |
| Molecular Formula | C36H38N2O6 |
| Molecular Weight | 594.71 g/mol |
| Exact Mass | 594.27 |
| IUPAC Name | 2-ethoxy-2-[2-methanimidoyl-4-[3-[4-(4-phenylbenzoyl)-2-propylphenoxy]propoxy]anilino]acetic acid |
| SMILES | [H]/N=C/c1cc(OCCCOc2ccc(C(=O)c3ccc(-c4ccccc4)cc3)cc2CCC)ccc1NC(OCC)C(=O)O |
| InChI | InChI=1S/C36H38N2O6/c1-3-9-28-22-29(34(39)27-14-12-26(13-15-27)25-10-6-5-7-11-25)16-19-33(28)44-21-8-20-43-31-17-18-32(30(23-31)24-37)38-35(36(40)41)42-4-2/h5-7,10-19,22-24,35,37-38H,3-4,8-9,20-21H2,1-2H3,(H,40,41)/b37-24+ |
| InChIKey | UNMNDBKIVYEWTO-HWLOXFRGSA-N |
| XLogP | 7.24 |
| TPSA | 117.94 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 594.71 |
| LogP ≤ 5 | 7.24 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|