C30H36N2O — CID 145199920
N-(1-ethoxybutyl)-2-methanimidoyl-4-[(E)-1-(4-methylphenyl)-2-phenylbut-1-enyl]aniline (PubChem CID 145199920) has the molecular formula C30H36N2O and a molecular weight of 440.63 g/mol. Its IUPAC name is N-(1-ethoxybutyl)-2-methanimidoyl-4-[(E)-1-(4-methylphenyl)-2-phenylbut-1-enyl]aniline.
| Compound Name | N-(1-ethoxybutyl)-2-methanimidoyl-4-[(E)-1-(4-methylphenyl)-2-phenylbut-1-enyl]aniline |
|---|---|
| PubChem CID | 145199920 |
| Molecular Formula | C30H36N2O |
| Molecular Weight | 440.63 g/mol |
| Exact Mass | 440.28 |
| IUPAC Name | N-(1-ethoxybutyl)-2-methanimidoyl-4-[(E)-1-(4-methylphenyl)-2-phenylbut-1-enyl]aniline |
| SMILES | [H]/N=C/c1cc(/C(=C(\CC)c2ccccc2)c2ccc(C)cc2)ccc1NC(CCC)OCC |
| InChI | InChI=1S/C30H36N2O/c1-5-11-29(33-7-3)32-28-19-18-25(20-26(28)21-31)30(24-16-14-22(4)15-17-24)27(6-2)23-12-9-8-10-13-23/h8-10,12-21,29,31-32H,5-7,11H2,1-4H3/b30-27+,31-21+ |
| InChIKey | ZJACWOGWYSOTDG-STPGNIRLSA-N |
| XLogP | 7.94 |
| TPSA | 45.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.63 |
| LogP ≤ 5 | 7.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|