C27H32KN — CID 155723292
potassium;1-[(Z)-1,2-diphenylbut-1-enyl]-4-methylbenzene;methyl(propyl)azanide (PubChem CID 155723292) has the molecular formula C27H32KN and a molecular weight of 409.66 g/mol. Its IUPAC name is potassium;1-[(Z)-1,2-diphenylbut-1-enyl]-4-methylbenzene;methyl(propyl)azanide.
| Compound Name | potassium;1-[(Z)-1,2-diphenylbut-1-enyl]-4-methylbenzene;methyl(propyl)azanide |
|---|---|
| PubChem CID | 155723292 |
| Molecular Formula | C27H32KN |
| Molecular Weight | 409.66 g/mol |
| Exact Mass | 409.22 |
| IUPAC Name | potassium;1-[(Z)-1,2-diphenylbut-1-enyl]-4-methylbenzene;methyl(propyl)azanide |
| SMILES | CC/C(=C(\c1ccccc1)c1ccc(C)cc1)c1ccccc1.CCC[N-]C.[K+] |
| InChI | InChI=1S/C23H22.C4H10N.K/c1-3-22(19-10-6-4-7-11-19)23(20-12-8-5-9-13-20)21-16-14-18(2)15-17-21;1-3-4-5-2;/h4-17H,3H2,1-2H3;3-4H2,1-2H3;/q;-1;+1/b23-22-;; |
| InChIKey | JCUAUVPLGQIZDL-PPNCFKIXSA-N |
| XLogP | 4.77 |
| TPSA | 14.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.66 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|