C34H39NO4 — CID 142048063
(Z)-N-[2-[4-[(E)-1,2-diphenylbut-1-enyl]phenoxy]ethyl]-6,9-dioxodec-7-enamide;molecular hydrogen (PubChem CID 142048063) has the molecular formula C34H39NO4 and a molecular weight of 525.69 g/mol. Its IUPAC name is (Z)-N-[2-[4-[(E)-1,2-diphenylbut-1-enyl]phenoxy]ethyl]-6,9-dioxodec-7-enamide;molecular hydrogen.
| Compound Name | (Z)-N-[2-[4-[(E)-1,2-diphenylbut-1-enyl]phenoxy]ethyl]-6,9-dioxodec-7-enamide;molecular hydrogen |
|---|---|
| PubChem CID | 142048063 |
| Molecular Formula | C34H39NO4 |
| Molecular Weight | 525.69 g/mol |
| Exact Mass | 525.29 |
| IUPAC Name | (Z)-N-[2-[4-[(E)-1,2-diphenylbut-1-enyl]phenoxy]ethyl]-6,9-dioxodec-7-enamide;molecular hydrogen |
| SMILES | CC/C(=C(/c1ccccc1)c1ccc(OCCNC(=O)CCCCC(=O)/C=C\C(C)=O)cc1)c1ccccc1.[H][H] |
| InChI | InChI=1S/C34H37NO4.H2/c1-3-32(27-12-6-4-7-13-27)34(28-14-8-5-9-15-28)29-19-22-31(23-20-29)39-25-24-35-33(38)17-11-10-16-30(37)21-18-26(2)36;/h4-9,12-15,18-23H,3,10-11,16-17,24-25H2,1-2H3,(H,35,38);1H/b21-18-,34-32+; |
| InChIKey | AZUJAINGHSNTPH-WRBBNMCZSA-N |
| XLogP | 7.07 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 525.69 |
| LogP ≤ 5 | 7.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|