C26H25NO4 — CID 3035470
2-[[2-[4-[(Z)-1,2-diphenylbut-1-enyl]phenoxy]acetyl]amino]acetic acid (PubChem CID 3035470) has the molecular formula C26H25NO4 and a molecular weight of 415.49 g/mol. Its IUPAC name is 2-[[2-[4-[(Z)-1,2-diphenylbut-1-enyl]phenoxy]acetyl]amino]acetic acid.
| Compound Name | 2-[[2-[4-[(Z)-1,2-diphenylbut-1-enyl]phenoxy]acetyl]amino]acetic acid |
|---|---|
| PubChem CID | 3035470 |
| Molecular Formula | C26H25NO4 |
| Molecular Weight | 415.49 g/mol |
| Exact Mass | 415.18 |
| IUPAC Name | 2-[[2-[4-[(Z)-1,2-diphenylbut-1-enyl]phenoxy]acetyl]amino]acetic acid |
| SMILES | CC/C(=C(\c1ccccc1)c1ccc(OCC(=O)NCC(=O)O)cc1)c1ccccc1 |
| InChI | InChI=1S/C26H25NO4/c1-2-23(19-9-5-3-6-10-19)26(20-11-7-4-8-12-20)21-13-15-22(16-14-21)31-18-24(28)27-17-25(29)30/h3-16H,2,17-18H2,1H3,(H,27,28)(H,29,30)/b26-23- |
| InChIKey | MSFNIRBACRRKGX-RWEWTDSWSA-N |
| XLogP | 4.64 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.49 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|