C26H26O2 — CID 88751480
(2S,3S)-2-[[4-[(E)-1,2-diphenylbut-1-enyl]phenoxy]methyl]-3-methyloxirane (PubChem CID 88751480) has the molecular formula C26H26O2 and a molecular weight of 370.49 g/mol. Its IUPAC name is (2S,3S)-2-[[4-[(E)-1,2-diphenylbut-1-enyl]phenoxy]methyl]-3-methyloxirane.
| Compound Name | (2S,3S)-2-[[4-[(E)-1,2-diphenylbut-1-enyl]phenoxy]methyl]-3-methyloxirane |
|---|---|
| PubChem CID | 88751480 |
| Molecular Formula | C26H26O2 |
| Molecular Weight | 370.49 g/mol |
| Exact Mass | 370.19 |
| IUPAC Name | (2S,3S)-2-[[4-[(E)-1,2-diphenylbut-1-enyl]phenoxy]methyl]-3-methyloxirane |
| SMILES | CC/C(=C(/c1ccccc1)c1ccc(OC[C@@H]2O[C@H]2C)cc1)c1ccccc1 |
| InChI | InChI=1S/C26H26O2/c1-3-24(20-10-6-4-7-11-20)26(21-12-8-5-9-13-21)22-14-16-23(17-15-22)27-18-25-19(2)28-25/h4-17,19,25H,3,18H2,1-2H3/b26-24+/t19-,25-/m0/s1 |
| InChIKey | JBRBQXCTLFLUNY-XJVCEKNMSA-N |
| XLogP | 6.22 |
| TPSA | 21.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.49 |
| LogP ≤ 5 | 6.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|