C29H29F4N5O2 — CID 134543888
2-methyl-4-[2-[[5-[(Z)-4,4,4-trifluoro-1-(3-fluoro-2H-indazol-5-yl)-2-phenylbut-1-enyl]-2-pyridinyl]oxy]ethylamino]butanamide (PubChem CID 134543888) has the molecular formula C29H29F4N5O2 and a molecular weight of 555.58 g/mol. Its IUPAC name is 2-methyl-4-[2-[[5-[(Z)-4,4,4-trifluoro-1-(3-fluoro-2H-indazol-5-yl)-2-phenylbut-1-enyl]-2-pyridinyl]oxy]ethylamino]butanamide.
| Compound Name | 2-methyl-4-[2-[[5-[(Z)-4,4,4-trifluoro-1-(3-fluoro-2H-indazol-5-yl)-2-phenylbut-1-enyl]-2-pyridinyl]oxy]ethylamino]butanamide |
|---|---|
| PubChem CID | 134543888 |
| Molecular Formula | C29H29F4N5O2 |
| Molecular Weight | 555.58 g/mol |
| Exact Mass | 555.23 |
| IUPAC Name | 2-methyl-4-[2-[[5-[(Z)-4,4,4-trifluoro-1-(3-fluoro-2H-indazol-5-yl)-2-phenylbut-1-enyl]-2-pyridinyl]oxy]ethylamino]butanamide |
| SMILES | CC(CCNCCOc1ccc(/C(=C(/CC(F)(F)F)c2ccccc2)c2ccc3n[nH]c(F)c3c2)cn1)C(N)=O |
| InChI | InChI=1S/C29H29F4N5O2/c1-18(28(34)39)11-12-35-13-14-40-25-10-8-21(17-36-25)26(20-7-9-24-22(15-20)27(30)38-37-24)23(16-29(31,32)33)19-5-3-2-4-6-19/h2-10,15,17-18,35H,11-14,16H2,1H3,(H2,34,39)(H,37,38)/b26-23- |
| InChIKey | KWKFGHQDDSOQHN-RWEWTDSWSA-N |
| XLogP | 5.49 |
| TPSA | 105.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 555.58 |
| LogP ≤ 5 | 5.49 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|