C32H34F4N4O2 — CID 163479146
N,N,3-trimethyl-4-[2-[4-[(E)-4,4,4-trifluoro-1-(3-fluoro-2H-indazol-5-yl)-2-phenylbut-1-enyl]phenoxy]ethylamino]butanamide (PubChem CID 163479146) has the molecular formula C32H34F4N4O2 and a molecular weight of 582.64 g/mol. Its IUPAC name is N,N,3-trimethyl-4-[2-[4-[(E)-4,4,4-trifluoro-1-(3-fluoro-2H-indazol-5-yl)-2-phenylbut-1-enyl]phenoxy]ethylamino]butanamide.
| Compound Name | N,N,3-trimethyl-4-[2-[4-[(E)-4,4,4-trifluoro-1-(3-fluoro-2H-indazol-5-yl)-2-phenylbut-1-enyl]phenoxy]ethylamino]butanamide |
|---|---|
| PubChem CID | 163479146 |
| Molecular Formula | C32H34F4N4O2 |
| Molecular Weight | 582.64 g/mol |
| Exact Mass | 582.26 |
| IUPAC Name | N,N,3-trimethyl-4-[2-[4-[(E)-4,4,4-trifluoro-1-(3-fluoro-2H-indazol-5-yl)-2-phenylbut-1-enyl]phenoxy]ethylamino]butanamide |
| SMILES | CC(CNCCOc1ccc(/C(=C(/CC(F)(F)F)c2ccccc2)c2ccc3n[nH]c(F)c3c2)cc1)CC(=O)N(C)C |
| InChI | InChI=1S/C32H34F4N4O2/c1-21(17-29(41)40(2)3)20-37-15-16-42-25-12-9-23(10-13-25)30(24-11-14-28-26(18-24)31(33)39-38-28)27(19-32(34,35)36)22-7-5-4-6-8-22/h4-14,18,21,37H,15-17,19-20H2,1-3H3,(H,38,39)/b30-27+ |
| InChIKey | CDAISPQZPLIUNC-KDJFERLWSA-N |
| XLogP | 6.70 |
| TPSA | 70.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 582.64 |
| LogP ≤ 5 | 6.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|