C32H34FN3O2 — CID 157175212
(E)-7-[4-[(E)-1-(3-fluoro-2H-indazol-5-yl)-3-methyl-2-phenylbut-1-enyl]phenoxy]-N-methylhept-2-enamide (PubChem CID 157175212) has the molecular formula C32H34FN3O2 and a molecular weight of 511.64 g/mol. Its IUPAC name is (E)-7-[4-[(E)-1-(3-fluoro-2H-indazol-5-yl)-3-methyl-2-phenylbut-1-enyl]phenoxy]-N-methylhept-2-enamide.
| Compound Name | (E)-7-[4-[(E)-1-(3-fluoro-2H-indazol-5-yl)-3-methyl-2-phenylbut-1-enyl]phenoxy]-N-methylhept-2-enamide |
|---|---|
| PubChem CID | 157175212 |
| Molecular Formula | C32H34FN3O2 |
| Molecular Weight | 511.64 g/mol |
| Exact Mass | 511.26 |
| IUPAC Name | (E)-7-[4-[(E)-1-(3-fluoro-2H-indazol-5-yl)-3-methyl-2-phenylbut-1-enyl]phenoxy]-N-methylhept-2-enamide |
| SMILES | CNC(=O)/C=C/CCCCOc1ccc(/C(=C(\c2ccccc2)C(C)C)c2ccc3n[nH]c(F)c3c2)cc1 |
| InChI | InChI=1S/C32H34FN3O2/c1-22(2)30(23-11-7-6-8-12-23)31(25-16-19-28-27(21-25)32(33)36-35-28)24-14-17-26(18-15-24)38-20-10-5-4-9-13-29(37)34-3/h6-9,11-19,21-22H,4-5,10,20H2,1-3H3,(H,34,37)(H,35,36)/b13-9+,31-30+ |
| InChIKey | ANXTWAOQFSEIIV-DCOKCWJWSA-N |
| XLogP | 7.17 |
| TPSA | 67.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.64 |
| LogP ≤ 5 | 7.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|