C29H20F4N4O2 — CID 123230853
(E)-3-[4-[(E)-2-cyclobutyl-1-(3-fluoro-2H-indazol-5-yl)-2-[3-isocyano-5-(trifluoromethyl)-2-pyridinyl]ethenyl]phenyl]prop-2-enoic acid (PubChem CID 123230853) has the molecular formula C29H20F4N4O2 and a molecular weight of 532.50 g/mol. Its IUPAC name is (E)-3-[4-[(E)-2-cyclobutyl-1-(3-fluoro-2H-indazol-5-yl)-2-[3-isocyano-5-(trifluoromethyl)-2-pyridinyl]ethenyl]phenyl]prop-2-enoic acid.
| Compound Name | (E)-3-[4-[(E)-2-cyclobutyl-1-(3-fluoro-2H-indazol-5-yl)-2-[3-isocyano-5-(trifluoromethyl)-2-pyridinyl]ethenyl]phenyl]prop-2-enoic acid |
|---|---|
| PubChem CID | 123230853 |
| Molecular Formula | C29H20F4N4O2 |
| Molecular Weight | 532.50 g/mol |
| Exact Mass | 532.15 |
| IUPAC Name | (E)-3-[4-[(E)-2-cyclobutyl-1-(3-fluoro-2H-indazol-5-yl)-2-[3-isocyano-5-(trifluoromethyl)-2-pyridinyl]ethenyl]phenyl]prop-2-enoic acid |
| SMILES | [C-]#[N+]c1cc(C(F)(F)F)cnc1/C(=C(\c1ccc(/C=C/C(=O)O)cc1)c1ccc2n[nH]c(F)c2c1)C1CCC1 |
| InChI | InChI=1S/C29H20F4N4O2/c1-34-23-14-20(29(31,32)33)15-35-27(23)26(17-3-2-4-17)25(18-8-5-16(6-9-18)7-12-24(38)39)19-10-11-22-21(13-19)28(30)37-36-22/h5-15,17H,2-4H2,(H,36,37)(H,38,39)/b12-7+,26-25+ |
| InChIKey | LBBAUWCNOXAIRB-URAYKRMZSA-N |
| XLogP | 7.52 |
| TPSA | 83.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.50 |
| LogP ≤ 5 | 7.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|