C28H31NO3 — CID 123588284
4-[3-(2,3-dihydro-1-benzofuran-5-yl)-2-[4-[2-(methylamino)ethoxy]phenyl]pent-2-enyl]phenol (PubChem CID 123588284) has the molecular formula C28H31NO3 and a molecular weight of 429.56 g/mol. Its IUPAC name is 4-[3-(2,3-dihydro-1-benzofuran-5-yl)-2-[4-[2-(methylamino)ethoxy]phenyl]pent-2-enyl]phenol.
| Compound Name | 4-[3-(2,3-dihydro-1-benzofuran-5-yl)-2-[4-[2-(methylamino)ethoxy]phenyl]pent-2-enyl]phenol |
|---|---|
| PubChem CID | 123588284 |
| Molecular Formula | C28H31NO3 |
| Molecular Weight | 429.56 g/mol |
| Exact Mass | 429.23 |
| IUPAC Name | 4-[3-(2,3-dihydro-1-benzofuran-5-yl)-2-[4-[2-(methylamino)ethoxy]phenyl]pent-2-enyl]phenol |
| SMILES | CCC(=C(Cc1ccc(O)cc1)c1ccc(OCCNC)cc1)c1ccc2c(c1)CCO2 |
| InChI | InChI=1S/C28H31NO3/c1-3-26(22-8-13-28-23(19-22)14-16-32-28)27(18-20-4-9-24(30)10-5-20)21-6-11-25(12-7-21)31-17-15-29-2/h4-13,19,29-30H,3,14-18H2,1-2H3 |
| InChIKey | PTVXLVBLSQXMJU-UHFFFAOYSA-N |
| XLogP | 5.49 |
| TPSA | 50.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.56 |
| LogP ≤ 5 | 5.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|