C30H32ClNO3 — CID 123354854
4-[4-(2-chloro-1-benzofuran-5-yl)-3-[4-[2-(ethylamino)ethoxy]phenyl]hex-3-enyl]phenol (PubChem CID 123354854) has the molecular formula C30H32ClNO3 and a molecular weight of 490.04 g/mol. Its IUPAC name is 4-[4-(2-chloro-1-benzofuran-5-yl)-3-[4-[2-(ethylamino)ethoxy]phenyl]hex-3-enyl]phenol.
| Compound Name | 4-[4-(2-chloro-1-benzofuran-5-yl)-3-[4-[2-(ethylamino)ethoxy]phenyl]hex-3-enyl]phenol |
|---|---|
| PubChem CID | 123354854 |
| Molecular Formula | C30H32ClNO3 |
| Molecular Weight | 490.04 g/mol |
| Exact Mass | 489.21 |
| IUPAC Name | 4-[4-(2-chloro-1-benzofuran-5-yl)-3-[4-[2-(ethylamino)ethoxy]phenyl]hex-3-enyl]phenol |
| SMILES | CCNCCOc1ccc(C(CCc2ccc(O)cc2)=C(CC)c2ccc3oc(Cl)cc3c2)cc1 |
| InChI | InChI=1S/C30H32ClNO3/c1-3-27(23-10-16-29-24(19-23)20-30(31)35-29)28(15-7-21-5-11-25(33)12-6-21)22-8-13-26(14-9-22)34-18-17-32-4-2/h5-6,8-14,16,19-20,32-33H,3-4,7,15,17-18H2,1-2H3 |
| InChIKey | OYPURDHMVIYJEK-UHFFFAOYSA-N |
| XLogP | 7.73 |
| TPSA | 54.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.04 |
| LogP ≤ 5 | 7.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|