C25H25IN2O3 — CID 167109919
N-amino-N-[2-[4-[(Z)-1-(4-hydroxyphenyl)-2-phenylbut-1-enyl]phenoxy]ethyl]carbamoyl iodide (PubChem CID 167109919) has the molecular formula C25H25IN2O3 and a molecular weight of 528.39 g/mol. Its IUPAC name is N-amino-N-[2-[4-[(Z)-1-(4-hydroxyphenyl)-2-phenylbut-1-enyl]phenoxy]ethyl]carbamoyl iodide.
| Compound Name | N-amino-N-[2-[4-[(Z)-1-(4-hydroxyphenyl)-2-phenylbut-1-enyl]phenoxy]ethyl]carbamoyl iodide |
|---|---|
| PubChem CID | 167109919 |
| Molecular Formula | C25H25IN2O3 |
| Molecular Weight | 528.39 g/mol |
| Exact Mass | 528.09 |
| IUPAC Name | N-amino-N-[2-[4-[(Z)-1-(4-hydroxyphenyl)-2-phenylbut-1-enyl]phenoxy]ethyl]carbamoyl iodide |
| SMILES | CC/C(=C(\c1ccc(O)cc1)c1ccc(OCCN(N)C(=O)I)cc1)c1ccccc1 |
| InChI | InChI=1S/C25H25IN2O3/c1-2-23(18-6-4-3-5-7-18)24(19-8-12-21(29)13-9-19)20-10-14-22(15-11-20)31-17-16-28(27)25(26)30/h3-15,29H,2,16-17,27H2,1H3/b24-23- |
| InChIKey | LCVULMXEMPMHCC-VHXPQNKSSA-N |
| XLogP | 5.87 |
| TPSA | 75.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.39 |
| LogP ≤ 5 | 5.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|