C34H36N2O — CID 175489943
4-[1-[4-[4-(aminomethyl)piperidin-1-yl]phenyl]-2-phenylbut-1-enyl]-2-phenylphenol (PubChem CID 175489943) has the molecular formula C34H36N2O and a molecular weight of 488.68 g/mol. Its IUPAC name is 4-[1-[4-[4-(aminomethyl)piperidin-1-yl]phenyl]-2-phenylbut-1-enyl]-2-phenylphenol.
| Compound Name | 4-[1-[4-[4-(aminomethyl)piperidin-1-yl]phenyl]-2-phenylbut-1-enyl]-2-phenylphenol |
|---|---|
| PubChem CID | 175489943 |
| Molecular Formula | C34H36N2O |
| Molecular Weight | 488.68 g/mol |
| Exact Mass | 488.28 |
| IUPAC Name | 4-[1-[4-[4-(aminomethyl)piperidin-1-yl]phenyl]-2-phenylbut-1-enyl]-2-phenylphenol |
| SMILES | CCC(=C(c1ccc(N2CCC(CN)CC2)cc1)c1ccc(O)c(-c2ccccc2)c1)c1ccccc1 |
| InChI | InChI=1S/C34H36N2O/c1-2-31(26-9-5-3-6-10-26)34(29-15-18-33(37)32(23-29)27-11-7-4-8-12-27)28-13-16-30(17-14-28)36-21-19-25(24-35)20-22-36/h3-18,23,25,37H,2,19-22,24,35H2,1H3 |
| InChIKey | KFBIZGXLCTYAHQ-UHFFFAOYSA-N |
| XLogP | 7.60 |
| TPSA | 49.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.68 |
| LogP ≤ 5 | 7.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|