C20H34O4S — CID 57108809
2-[2-(4-octylphenyl)ethoxy]ethyl ethanesulfonate (PubChem CID 57108809) has the molecular formula C20H34O4S and a molecular weight of 370.56 g/mol. Its IUPAC name is 2-[2-(4-octylphenyl)ethoxy]ethyl ethanesulfonate.
| Compound Name | 2-[2-(4-octylphenyl)ethoxy]ethyl ethanesulfonate |
|---|---|
| PubChem CID | 57108809 |
| Molecular Formula | C20H34O4S |
| Molecular Weight | 370.56 g/mol |
| Exact Mass | 370.22 |
| IUPAC Name | 2-[2-(4-octylphenyl)ethoxy]ethyl ethanesulfonate |
| SMILES | CCCCCCCCc1ccc(CCOCCOS(=O)(=O)CC)cc1 |
| InChI | InChI=1S/C20H34O4S/c1-3-5-6-7-8-9-10-19-11-13-20(14-12-19)15-16-23-17-18-24-25(21,22)4-2/h11-14H,3-10,15-18H2,1-2H3 |
| InChIKey | INAOPKHUVIAOLL-UHFFFAOYSA-N |
| XLogP | 4.51 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.56 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|