C20H35KO2S — CID 175472561
potassium;hydride;3-[2-(4-nonylphenoxy)ethoxy]propane-1-thiol (PubChem CID 175472561) has the molecular formula C20H35KO2S and a molecular weight of 378.66 g/mol. Its IUPAC name is potassium;hydride;3-[2-(4-nonylphenoxy)ethoxy]propane-1-thiol.
| Compound Name | potassium;hydride;3-[2-(4-nonylphenoxy)ethoxy]propane-1-thiol |
|---|---|
| PubChem CID | 175472561 |
| Molecular Formula | C20H35KO2S |
| Molecular Weight | 378.66 g/mol |
| Exact Mass | 378.20 |
| IUPAC Name | potassium;hydride;3-[2-(4-nonylphenoxy)ethoxy]propane-1-thiol |
| SMILES | CCCCCCCCCc1ccc(OCCOCCCS)cc1.[H-].[K+] |
| InChI | InChI=1S/C20H34O2S.K.H/c1-2-3-4-5-6-7-8-10-19-11-13-20(14-12-19)22-17-16-21-15-9-18-23;;/h11-14,23H,2-10,15-18H2,1H3;;/q;+1;-1 |
| InChIKey | MAPWJOWUAFTVSX-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 18.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.66 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|