C22H25N3O6 — CID 135597465
5-ethoxy-2-[4-(4-ethoxy-2-hydroxyphenyl)-6-(2-methoxyethoxy)-1,3,5-triazin-2-yl]phenol (PubChem CID 135597465) has the molecular formula C22H25N3O6 and a molecular weight of 427.46 g/mol. Its IUPAC name is 5-ethoxy-2-[4-(4-ethoxy-2-hydroxyphenyl)-6-(2-methoxyethoxy)-1,3,5-triazin-2-yl]phenol.
| Compound Name | 5-ethoxy-2-[4-(4-ethoxy-2-hydroxyphenyl)-6-(2-methoxyethoxy)-1,3,5-triazin-2-yl]phenol |
|---|---|
| PubChem CID | 135597465 |
| Molecular Formula | C22H25N3O6 |
| Molecular Weight | 427.46 g/mol |
| Exact Mass | 427.17 |
| IUPAC Name | 5-ethoxy-2-[4-(4-ethoxy-2-hydroxyphenyl)-6-(2-methoxyethoxy)-1,3,5-triazin-2-yl]phenol |
| SMILES | CCOc1ccc(-c2nc(OCCOC)nc(-c3ccc(OCC)cc3O)n2)c(O)c1 |
| InChI | InChI=1S/C22H25N3O6/c1-4-29-14-6-8-16(18(26)12-14)20-23-21(25-22(24-20)31-11-10-28-3)17-9-7-15(30-5-2)13-19(17)27/h6-9,12-13,26-27H,4-5,10-11H2,1-3H3 |
| InChIKey | KOEXKVIAHBUXCE-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 116.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.46 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|