C19H19N3O3 — CID 163676700
2-[4-butoxy-6-(2-hydroxyphenyl)-1,3,5-triazin-2-yl]phenol (PubChem CID 163676700) has the molecular formula C19H19N3O3 and a molecular weight of 337.38 g/mol. Its IUPAC name is 2-[4-butoxy-6-(2-hydroxyphenyl)-1,3,5-triazin-2-yl]phenol.
| Compound Name | 2-[4-butoxy-6-(2-hydroxyphenyl)-1,3,5-triazin-2-yl]phenol |
|---|---|
| PubChem CID | 163676700 |
| Molecular Formula | C19H19N3O3 |
| Molecular Weight | 337.38 g/mol |
| Exact Mass | 337.14 |
| IUPAC Name | 2-[4-butoxy-6-(2-hydroxyphenyl)-1,3,5-triazin-2-yl]phenol |
| SMILES | CCCCOc1nc(-c2ccccc2O)nc(-c2ccccc2O)n1 |
| InChI | InChI=1S/C19H19N3O3/c1-2-3-12-25-19-21-17(13-8-4-6-10-15(13)23)20-18(22-19)14-9-5-7-11-16(14)24/h4-11,23-24H,2-3,12H2,1H3 |
| InChIKey | JHHDNGCJBGDYFJ-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 88.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.38 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|