C28H19N3O4 — CID 164768650
2-(4-chrysen-6-yl-6-methoxy-1,3,5-triazin-2-yl)benzene-1,3,5-triol (PubChem CID 164768650) has the molecular formula C28H19N3O4 and a molecular weight of 461.48 g/mol. Its IUPAC name is 2-(4-chrysen-6-yl-6-methoxy-1,3,5-triazin-2-yl)benzene-1,3,5-triol.
| Compound Name | 2-(4-chrysen-6-yl-6-methoxy-1,3,5-triazin-2-yl)benzene-1,3,5-triol |
|---|---|
| PubChem CID | 164768650 |
| Molecular Formula | C28H19N3O4 |
| Molecular Weight | 461.48 g/mol |
| Exact Mass | 461.14 |
| IUPAC Name | 2-(4-chrysen-6-yl-6-methoxy-1,3,5-triazin-2-yl)benzene-1,3,5-triol |
| SMILES | COc1nc(-c2c(O)cc(O)cc2O)nc(-c2cc3c4ccccc4ccc3c3ccccc23)n1 |
| InChI | InChI=1S/C28H19N3O4/c1-35-28-30-26(29-27(31-28)25-23(33)12-16(32)13-24(25)34)22-14-21-17-7-3-2-6-15(17)10-11-20(21)18-8-4-5-9-19(18)22/h2-14,32-34H,1H3 |
| InChIKey | WAKVODSXNKIRQR-UHFFFAOYSA-N |
| XLogP | 5.79 |
| TPSA | 108.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.48 |
| LogP ≤ 5 | 5.79 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|