C26H17N3O3 — CID 164768815
4-(4-methoxy-6-pyren-1-yl-1,3,5-triazin-2-yl)benzene-1,3-diol (PubChem CID 164768815) has the molecular formula C26H17N3O3 and a molecular weight of 419.44 g/mol. Its IUPAC name is 4-(4-methoxy-6-pyren-1-yl-1,3,5-triazin-2-yl)benzene-1,3-diol.
| Compound Name | 4-(4-methoxy-6-pyren-1-yl-1,3,5-triazin-2-yl)benzene-1,3-diol |
|---|---|
| PubChem CID | 164768815 |
| Molecular Formula | C26H17N3O3 |
| Molecular Weight | 419.44 g/mol |
| Exact Mass | 419.13 |
| IUPAC Name | 4-(4-methoxy-6-pyren-1-yl-1,3,5-triazin-2-yl)benzene-1,3-diol |
| SMILES | COc1nc(-c2ccc(O)cc2O)nc(-c2ccc3ccc4cccc5ccc2c3c45)n1 |
| InChI | InChI=1S/C26H17N3O3/c1-32-26-28-24(27-25(29-26)20-12-9-17(30)13-21(20)31)19-11-8-16-6-5-14-3-2-4-15-7-10-18(19)23(16)22(14)15/h2-13,30-31H,1H3 |
| InChIKey | XBLRXGQAGUJDOU-UHFFFAOYSA-N |
| XLogP | 5.52 |
| TPSA | 88.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.44 |
| LogP ≤ 5 | 5.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|