C36H39N3O2S — CID 146499852
2-(4-cyclopentylsulfanyl-6-phenanthren-9-yl-1,3,5-triazin-2-yl)-5-(2-ethylhexoxy)phenol (PubChem CID 146499852) has the molecular formula C36H39N3O2S and a molecular weight of 577.79 g/mol. Its IUPAC name is 2-(4-cyclopentylsulfanyl-6-phenanthren-9-yl-1,3,5-triazin-2-yl)-5-(2-ethylhexoxy)phenol.
| Compound Name | 2-(4-cyclopentylsulfanyl-6-phenanthren-9-yl-1,3,5-triazin-2-yl)-5-(2-ethylhexoxy)phenol |
|---|---|
| PubChem CID | 146499852 |
| Molecular Formula | C36H39N3O2S |
| Molecular Weight | 577.79 g/mol |
| Exact Mass | 577.28 |
| IUPAC Name | 2-(4-cyclopentylsulfanyl-6-phenanthren-9-yl-1,3,5-triazin-2-yl)-5-(2-ethylhexoxy)phenol |
| SMILES | CCCCC(CC)COc1ccc(-c2nc(SC3CCCC3)nc(-c3cc4ccccc4c4ccccc34)n2)c(O)c1 |
| InChI | InChI=1S/C36H39N3O2S/c1-3-5-12-24(4-2)23-41-26-19-20-31(33(40)22-26)34-37-35(39-36(38-34)42-27-14-7-8-15-27)32-21-25-13-6-9-16-28(25)29-17-10-11-18-30(29)32/h6,9-11,13,16-22,24,27,40H,3-5,7-8,12,14-15,23H2,1-2H3 |
| InChIKey | ZMUWRHNDXDTUIC-UHFFFAOYSA-N |
| XLogP | 9.85 |
| TPSA | 68.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 577.79 |
| LogP ≤ 5 | 9.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|