C43H51N3O2S — CID 164768586
2-[4-(9,10-dihydrochrysen-6-yl)-6-(2-ethylhexylsulfanyl)-1,3,5-triazin-2-yl]-5-(2-ethylhexoxy)phenol (PubChem CID 164768586) has the molecular formula C43H51N3O2S and a molecular weight of 673.97 g/mol. Its IUPAC name is 2-[4-(9,10-dihydrochrysen-6-yl)-6-(2-ethylhexylsulfanyl)-1,3,5-triazin-2-yl]-5-(2-ethylhexoxy)phenol.
| Compound Name | 2-[4-(9,10-dihydrochrysen-6-yl)-6-(2-ethylhexylsulfanyl)-1,3,5-triazin-2-yl]-5-(2-ethylhexoxy)phenol |
|---|---|
| PubChem CID | 164768586 |
| Molecular Formula | C43H51N3O2S |
| Molecular Weight | 673.97 g/mol |
| Exact Mass | 673.37 |
| IUPAC Name | 2-[4-(9,10-dihydrochrysen-6-yl)-6-(2-ethylhexylsulfanyl)-1,3,5-triazin-2-yl]-5-(2-ethylhexoxy)phenol |
| SMILES | CCCCC(CC)COc1ccc(-c2nc(SCC(CC)CCCC)nc(-c3cc4c(ccc5ccccc54)c4c3C=CCC4)n2)c(O)c1 |
| InChI | InChI=1S/C43H51N3O2S/c1-5-9-15-29(7-3)27-48-32-22-24-37(40(47)25-32)41-44-42(46-43(45-41)49-28-30(8-4)16-10-6-2)39-26-38-33-18-12-11-17-31(33)21-23-36(38)34-19-13-14-20-35(34)39/h11-12,14,17-18,20-26,29-30,47H,5-10,13,15-16,19,27-28H2,1-4H3 |
| InChIKey | JWLFAXUVLBVGJH-UHFFFAOYSA-N |
| XLogP | 12.08 |
| TPSA | 68.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 673.97 |
| LogP ≤ 5 | 12.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|