C51H66N4O7 — CID 175959954
N-[7-[4-[4,6-bis[4-(2-ethylhexoxy)-2-hydroxyphenyl]-1,3,5-triazin-2-yl]phenoxy]heptyl]-2-hydroxybenzamide (PubChem CID 175959954) has the molecular formula C51H66N4O7 and a molecular weight of 847.11 g/mol. Its IUPAC name is N-[7-[4-[4,6-bis[4-(2-ethylhexoxy)-2-hydroxyphenyl]-1,3,5-triazin-2-yl]phenoxy]heptyl]-2-hydroxybenzamide.
| Compound Name | N-[7-[4-[4,6-bis[4-(2-ethylhexoxy)-2-hydroxyphenyl]-1,3,5-triazin-2-yl]phenoxy]heptyl]-2-hydroxybenzamide |
|---|---|
| PubChem CID | 175959954 |
| Molecular Formula | C51H66N4O7 |
| Molecular Weight | 847.11 g/mol |
| Exact Mass | 846.49 |
| IUPAC Name | N-[7-[4-[4,6-bis[4-(2-ethylhexoxy)-2-hydroxyphenyl]-1,3,5-triazin-2-yl]phenoxy]heptyl]-2-hydroxybenzamide |
| SMILES | CCCCC(CC)COc1ccc(-c2nc(-c3ccc(OCCCCCCCNC(=O)c4ccccc4O)cc3)nc(-c3ccc(OCC(CC)CCCC)cc3O)n2)c(O)c1 |
| InChI | InChI=1S/C51H66N4O7/c1-5-9-18-36(7-3)34-61-40-26-28-42(46(57)32-40)49-53-48(54-50(55-49)43-29-27-41(33-47(43)58)62-35-37(8-4)19-10-6-2)38-22-24-39(25-23-38)60-31-17-13-11-12-16-30-52-51(59)44-20-14-15-21-45(44)56/h14-15,20-29,32-33,36-37,56-58H,5-13,16-19,30-31,34-35H2,1-4H3,(H,52,59) |
| InChIKey | QRVVNUTYOYXRAK-UHFFFAOYSA-N |
| XLogP | 11.94 |
| TPSA | 156.15 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 27 |
| Heavy Atoms | 62 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 847.11 |
| LogP ≤ 5 | 11.94 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|