C20H24N2O3 — CID 121407399
3-[4-(2-ethylhexoxy)phenyl]-2H-pyrrolo[3,4-c]pyrrole-4,6-dione (PubChem CID 121407399) has the molecular formula C20H24N2O3 and a molecular weight of 340.42 g/mol. Its IUPAC name is 3-[4-(2-ethylhexoxy)phenyl]-2H-pyrrolo[3,4-c]pyrrole-4,6-dione.
| Compound Name | 3-[4-(2-ethylhexoxy)phenyl]-2H-pyrrolo[3,4-c]pyrrole-4,6-dione |
|---|---|
| PubChem CID | 121407399 |
| Molecular Formula | C20H24N2O3 |
| Molecular Weight | 340.42 g/mol |
| Exact Mass | 340.18 |
| IUPAC Name | 3-[4-(2-ethylhexoxy)phenyl]-2H-pyrrolo[3,4-c]pyrrole-4,6-dione |
| SMILES | CCCCC(CC)COc1ccc(-c2[nH]cc3c2C(=O)NC3=O)cc1 |
| InChI | InChI=1S/C20H24N2O3/c1-3-5-6-13(4-2)12-25-15-9-7-14(8-10-15)18-17-16(11-21-18)19(23)22-20(17)24/h7-11,13,21H,3-6,12H2,1-2H3,(H,22,23,24) |
| InChIKey | CSTNROCKRIEHGS-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 71.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.42 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|