C24H25IO2 — CID 163627333
2-dec-1-en-3-yl-7-iodophenanthrene-9,10-dione (PubChem CID 163627333) has the molecular formula C24H25IO2 and a molecular weight of 472.37 g/mol. Its IUPAC name is 2-dec-1-en-3-yl-7-iodophenanthrene-9,10-dione.
| Compound Name | 2-dec-1-en-3-yl-7-iodophenanthrene-9,10-dione |
|---|---|
| PubChem CID | 163627333 |
| Molecular Formula | C24H25IO2 |
| Molecular Weight | 472.37 g/mol |
| Exact Mass | 472.09 |
| IUPAC Name | 2-dec-1-en-3-yl-7-iodophenanthrene-9,10-dione |
| SMILES | C=CC(CCCCCCC)c1ccc2c(c1)C(=O)C(=O)c1cc(I)ccc1-2 |
| InChI | InChI=1S/C24H25IO2/c1-3-5-6-7-8-9-16(4-2)17-10-12-19-20-13-11-18(25)15-22(20)24(27)23(26)21(19)14-17/h4,10-16H,2-3,5-9H2,1H3 |
| InChIKey | HTCZGLFFYLJQQT-UHFFFAOYSA-N |
| XLogP | 6.97 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.37 |
| LogP ≤ 5 | 6.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'quinone_D(2)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|