C42H64I2O2P2 — CID 102523622
5,10-bis(2-hexyloctyl)-2,7-diiodophosphindolo[3,2-b]phosphindole 5,10-dioxide (PubChem CID 102523622) has the molecular formula C42H64I2O2P2 and a molecular weight of 916.73 g/mol. Its IUPAC name is 5,10-bis(2-hexyloctyl)-2,7-diiodophosphindolo[3,2-b]phosphindole 5,10-dioxide.
| Compound Name | 5,10-bis(2-hexyloctyl)-2,7-diiodophosphindolo[3,2-b]phosphindole 5,10-dioxide |
|---|---|
| PubChem CID | 102523622 |
| Molecular Formula | C42H64I2O2P2 |
| Molecular Weight | 916.73 g/mol |
| Exact Mass | 916.25 |
| IUPAC Name | 5,10-bis(2-hexyloctyl)-2,7-diiodophosphindolo[3,2-b]phosphindole 5,10-dioxide |
| SMILES | CCCCCCC(CCCCCC)CP1(=O)C2=C(c3ccc(I)cc31)P(=O)(CC(CCCCCC)CCCCCC)c1cc(I)ccc12 |
| InChI | InChI=1S/C42H64I2O2P2/c1-5-9-13-17-21-33(22-18-14-10-6-2)31-47(45)39-29-35(43)25-27-37(39)42-41(47)38-28-26-36(44)30-40(38)48(42,46)32-34(23-19-15-11-7-3)24-20-16-12-8-4/h25-30,33-34H,5-24,31-32H2,1-4H3 |
| InChIKey | ITSXBWYXQKZLTD-UHFFFAOYSA-N |
| XLogP | 14.84 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 24 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 916.73 |
| LogP ≤ 5 | 14.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|