C26H46S2SiSn2 — CID 90218027
5,5'-bis(trimethylstannyl)-3,3'-dihexylsilylene-2,2'-bithiophene (PubChem CID 90218027) has the molecular formula C26H46S2SiSn2 and a molecular weight of 688.30 g/mol.
| Compound Name | 5,5'-bis(trimethylstannyl)-3,3'-dihexylsilylene-2,2'-bithiophene |
|---|---|
| PubChem CID | 90218027 |
| Molecular Formula | C26H46S2SiSn2 |
| Molecular Weight | 688.30 g/mol |
| Exact Mass | 690.09 |
| IUPAC Name | — |
| SMILES | CCCCCCC1=C(c2sc([Sn](C)(C)C)cc2CCCCCC)S(=[Si])C([Sn](C)(C)C)=C1 |
| InChI | InChI=1S/C20H28S2Si.6CH3.2Sn/c1-3-5-7-9-11-17-13-15-21-19(17)20-18(14-16-22(20)23)12-10-8-6-4-2;;;;;;;;/h13-14H,3-12H2,1-2H3;6*1H3;; |
| InChIKey | NLCDRHGQNJGWSN-UHFFFAOYSA-N |
| XLogP | 9.22 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 31 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 688.30 |
| LogP ≤ 5 | 9.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|