C13H14N2S3 — CID 145071249
2-[(1Z)-1-methylsulfanylbuta-1,3-dienyl]-5-thiophen-2-ylthiophene-3,4-diamine (PubChem CID 145071249) has the molecular formula C13H14N2S3 and a molecular weight of 294.47 g/mol. Its IUPAC name is 2-[(1Z)-1-methylsulfanylbuta-1,3-dienyl]-5-thiophen-2-ylthiophene-3,4-diamine.
| Compound Name | 2-[(1Z)-1-methylsulfanylbuta-1,3-dienyl]-5-thiophen-2-ylthiophene-3,4-diamine |
|---|---|
| PubChem CID | 145071249 |
| Molecular Formula | C13H14N2S3 |
| Molecular Weight | 294.47 g/mol |
| Exact Mass | 294.03 |
| IUPAC Name | 2-[(1Z)-1-methylsulfanylbuta-1,3-dienyl]-5-thiophen-2-ylthiophene-3,4-diamine |
| SMILES | C=C/C=C(\SC)c1sc(-c2cccs2)c(N)c1N |
| InChI | InChI=1S/C13H14N2S3/c1-3-5-8(16-2)12-10(14)11(15)13(18-12)9-6-4-7-17-9/h3-7H,1,14-15H2,2H3/b8-5- |
| InChIKey | RHBFEQRXBHLYQR-YVMONPNESA-N |
| XLogP | 4.53 |
| TPSA | 52.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.47 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|