C24H15ClN2O4S2 — CID 90931776
6-chloro-13-methyl-2-(1-methylsulfanylbuta-1,3-dienyl)-9-thiophen-2-yl-6,13-diazatetracyclo[6.6.2.04,16.011,15]hexadeca-1,3,8(16),9,11(15)-pentaene-5,7,12,14-tetrone (PubChem CID 90931776) has the molecular formula C24H15ClN2O4S2 and a molecular weight of 494.98 g/mol. Its IUPAC name is 6-chloro-13-methyl-2-(1-methylsulfanylbuta-1,3-dienyl)-9-thiophen-2-yl-6,13-diazatetracyclo[6.6.2.04,16.011,15]hexadeca-1,3,8(16),9,11(15)-pentaene-5,7,12,14-tetrone.
| Compound Name | 6-chloro-13-methyl-2-(1-methylsulfanylbuta-1,3-dienyl)-9-thiophen-2-yl-6,13-diazatetracyclo[6.6.2.04,16.011,15]hexadeca-1,3,8(16),9,11(15)-pentaene-5,7,12,14-tetrone |
|---|---|
| PubChem CID | 90931776 |
| Molecular Formula | C24H15ClN2O4S2 |
| Molecular Weight | 494.98 g/mol |
| Exact Mass | 494.02 |
| IUPAC Name | 6-chloro-13-methyl-2-(1-methylsulfanylbuta-1,3-dienyl)-9-thiophen-2-yl-6,13-diazatetracyclo[6.6.2.04,16.011,15]hexadeca-1,3,8(16),9,11(15)-pentaene-5,7,12,14-tetrone |
| SMILES | C=CC=C(SC)c1cc2c3c(c(-c4cccs4)cc4c3c1C(=O)N(C)C4=O)C(=O)N(Cl)C2=O |
| InChI | InChI=1S/C24H15ClN2O4S2/c1-4-6-15(32-3)11-9-14-18-17-13(21(28)26(2)23(30)19(11)17)10-12(16-7-5-8-33-16)20(18)24(31)27(25)22(14)29/h4-10H,1H2,2-3H3 |
| InChIKey | VMJYYOABQCQWDX-UHFFFAOYSA-N |
| XLogP | 5.43 |
| TPSA | 74.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.98 |
| LogP ≤ 5 | 5.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'N-halo', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|