C25H22ClN3OS2 — CID 142989811
7-[4-(3-chloropropoxy)phenyl]-3-[(1Z)-1-methylsulfanylbuta-1,3-dienyl]-2-thiophen-2-ylpyrido[2,3-b]pyrazine (PubChem CID 142989811) has the molecular formula C25H22ClN3OS2 and a molecular weight of 480.06 g/mol. Its IUPAC name is 7-[4-(3-chloropropoxy)phenyl]-3-[(1Z)-1-methylsulfanylbuta-1,3-dienyl]-2-thiophen-2-ylpyrido[2,3-b]pyrazine.
| Compound Name | 7-[4-(3-chloropropoxy)phenyl]-3-[(1Z)-1-methylsulfanylbuta-1,3-dienyl]-2-thiophen-2-ylpyrido[2,3-b]pyrazine |
|---|---|
| PubChem CID | 142989811 |
| Molecular Formula | C25H22ClN3OS2 |
| Molecular Weight | 480.06 g/mol |
| Exact Mass | 479.09 |
| IUPAC Name | 7-[4-(3-chloropropoxy)phenyl]-3-[(1Z)-1-methylsulfanylbuta-1,3-dienyl]-2-thiophen-2-ylpyrido[2,3-b]pyrazine |
| SMILES | C=C/C=C(\SC)c1nc2ncc(-c3ccc(OCCCCl)cc3)cc2nc1-c1cccs1 |
| InChI | InChI=1S/C25H22ClN3OS2/c1-3-6-21(31-2)23-24(22-7-4-14-32-22)28-20-15-18(16-27-25(20)29-23)17-8-10-19(11-9-17)30-13-5-12-26/h3-4,6-11,14-16H,1,5,12-13H2,2H3/b21-6- |
| InChIKey | WAYAXMPRDJHDCY-MPUCSWFWSA-N |
| XLogP | 7.32 |
| TPSA | 47.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.06 |
| LogP ≤ 5 | 7.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|